CAS 898808-59-8

3-(Cyclohexylthio)-5-nitrobenzenamine

Description:

3-(Cyclohexylthio)-5-nitrobenzenamine is an organic compound characterized by its aromatic structure, which includes a nitro group and an amine functional group. The presence of the cyclohexylthio group introduces a sulfur atom bonded to a cyclohexyl ring, contributing to the compound's unique properties. This compound typically exhibits moderate solubility in organic solvents due to its hydrophobic cyclohexyl group, while the nitro and amine groups can engage in hydrogen bonding, influencing its reactivity and interaction with other molecules. The nitro group is known for its electron-withdrawing properties, which can affect the compound's electronic characteristics and reactivity in chemical reactions. Additionally, the amine group can participate in nucleophilic reactions, making this compound potentially useful in various synthetic applications. Safety and handling considerations should be taken into account, as compounds containing nitro and amine functionalities can pose health risks. Overall, 3-(Cyclohexylthio)-5-nitrobenzenamine is a compound of interest in organic synthesis and materials science.

Formula: C₁₂H₁₆N₂O₂S

InChI: InChI=1S/C12H16N2O2S/c13-9-6-10(14(15)16)8-12(7-9)17-11-4-2-1-3-5-11/h6-8,11H,1-5,13H2

InChI key: InChIKey=WARDSNBFFKRZAZ-UHFFFAOYSA-N

SMILES: S(C1=CC(N(=O)=O)=CC(N)=C1)C2CCCCC2

Synonyms:

• 3-Cyclohexylsulfanyl-5-nitroaniline
• Benzenamine, 3-(cyclohexylthio)-5-nitro-
• 3-(Cyclohexylthio)-5-nitrobenzenamine