CAS 898808-61-2
:pyrimidine, 1-[(2-chlorophenyl)methyl]hexahydro-
Description:
Pyrimidine, 1-[(2-chlorophenyl)methyl]hexahydro- is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a hexahydro group, indicating that it has a saturated, cyclic structure that contributes to its overall stability and reactivity. The presence of the 2-chlorophenyl group suggests that the compound has potential for various interactions due to the electronegative chlorine atom, which can influence its chemical behavior and biological activity. Pyrimidines are known for their role in biological systems, particularly in nucleic acids, and derivatives like this one may exhibit pharmacological properties. The specific substitution patterns and functional groups can affect solubility, melting point, and reactivity, making this compound of interest in medicinal chemistry and drug design. Overall, the unique combination of the pyrimidine core and the substituents provides a foundation for exploring its potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C11H15ClN2
InChI:InChI=1/C11H15ClN2/c12-11-5-2-1-4-10(11)8-14-7-3-6-13-9-14/h1-2,4-5,13H,3,6-9H2
SMILES:c1ccc(c(c1)CN1CCCNC1)Cl
Synonyms:- 1-(2-Chlorobenzyl)Hexahydropyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
