CAS 898808-64-5

2-Ethyl-3,4-dihydro-6-methyl-2H-1,4-benzoxazine

Description:

2-Ethyl-3,4-dihydro-6-methyl-2H-1,4-benzoxazine is an organic compound characterized by its unique bicyclic structure, which includes a benzene ring fused to a heterocyclic oxazine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of nitrogen and oxygen in its structure. It is likely to be a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of ethyl and methyl substituents contributes to its hydrophobic characteristics, influencing its solubility in organic solvents while being less soluble in water. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its specific applications and reactivity would depend on further studies, including its interaction with other chemical species and its behavior under various conditions. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₁H₁₅NO

InChI: InChI=1S/C11H15NO/c1-3-9-7-12-10-6-8(2)4-5-11(10)13-9/h4-6,9,12H,3,7H2,1-2H3

InChI key: InChIKey=PDPZENUKJADJEN-UHFFFAOYSA-N

SMILES: C(C)C1OC=2C(=CC(C)=CC2)NC1

Synonyms:

• 2-Ethyl-3,4-dihydro-6-methyl-2H-1,4-benzoxazine
• 2H-1,4-Benzoxazine, 2-ethyl-3,4-dihydro-6-methyl-
• 2-Ethyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine