CAS 898808-65-6

2,3,4,5-Tetrahydro-2-methyl-4-oxo-1,5-benzothiazepine-7-sulfonyl chloride

Description:

2,3,4,5-Tetrahydro-2-methyl-4-oxo-1,5-benzothiazepine-7-sulfonyl chloride is a chemical compound characterized by its complex bicyclic structure, which includes a benzothiazepine core. This compound features a sulfonyl chloride functional group, which is known for its reactivity, particularly in nucleophilic substitution reactions. The presence of the tetrahydro and methyl groups contributes to its unique stereochemistry and potential biological activity. Typically, compounds of this nature may exhibit properties such as moderate to high solubility in polar solvents and may be sensitive to moisture due to the sulfonyl chloride group. This compound may be of interest in medicinal chemistry for its potential pharmacological applications, particularly in the development of new therapeutic agents. However, handling precautions are necessary due to the reactive nature of the sulfonyl chloride, which can release hydrochloric acid upon hydrolysis. As with many specialized chemical substances, detailed safety data and handling guidelines should be consulted before use.

Formula: C₁₀H₁₀ClNO₃S₂

InChI: InChI=1S/C10H10ClNO3S2/c1-6-4-10(13)12-8-5-7(17(11,14)15)2-3-9(8)16-6/h2-3,5-6H,4H2,1H3,(H,12,13)

InChI key: InChIKey=KOQPZJTYPVPIHW-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C=C2C(=CC1)SC(C)CC(=O)N2

Synonyms:

• 1,5-Benzothiazepine-7-sulfonyl chloride, 2,3,4,5-tetrahydro-2-methyl-4-oxo-
• 2-Methyl-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepine-7-sulfonyl chloride
• 2,3,4,5-Tetrahydro-2-methyl-4-oxo-1,5-benzothiazepine-7-sulfonyl chloride