
CAS 898817-61-3
:(3aS,4S,6R,6aR)-6-Ethenyltetrahydro-2,2,6-trimethyl-4H-cyclopenta-1,3-dioxol-4-ol
Description:
The chemical substance known as "(3aS,4S,6R,6aR)-6-Ethenyltetrahydro-2,2,6-trimethyl-4H-cyclopenta-1,3-dioxol-4-ol" with the CAS number "898817-61-3" is characterized by its complex cyclic structure, which includes a dioxolane ring and multiple chiral centers. This compound features a tetrahydro-cyclopentane framework, contributing to its unique stereochemistry and potential biological activity. The presence of the ethenyl group suggests reactivity that may be exploited in synthetic applications or interactions with biological targets. Its trimethyl groups enhance hydrophobic characteristics, which can influence solubility and permeability in biological systems. The specific stereochemistry indicated by the (3aS,4S,6R,6aR) notation suggests that the compound may exhibit specific interactions with enzymes or receptors, potentially leading to unique pharmacological properties. Overall, this compound's structural features may make it of interest in medicinal chemistry and materials science, although detailed studies would be necessary to fully elucidate its properties and applications.
Formula:C11H18O3
InChI:InChI=1S/C11H18O3/c1-5-11(4)6-7(12)8-9(11)14-10(2,3)13-8/h5,7-9,12H,1,6H2,2-4H3/t7-,8-,9-,11-/m0/s1
InChI key:InChIKey=WRDMUYHMGXMDDA-KBIXCLLPSA-N
SMILES:C(=C)[C@]1(C)[C@@]2([C@@](OC(C)(C)O2)([C@@H](O)C1)[H])[H]
Synonyms:- (3aS,4S,6R,6aR)-6-Ethenyltetrahydro-2,2,6-trimethyl-4H-cyclopenta-1,3-dioxol-4-ol
- 4H-Cyclopenta-1,3-dioxol-4-ol, 6-ethenyltetrahydro-2,2,6-trimethyl-, (3aS,4S,6R,6aR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.