CAS 89885-26-7
:Phenyltrimethoxysilane homopolymer
Description:
Phenyltrimethoxysilane homopolymer, identified by CAS number 89885-26-7, is a silane-based compound characterized by its unique structure that incorporates phenyl groups and methoxy functionalities. This polymer exhibits excellent adhesion properties, making it suitable for use in coatings, sealants, and adhesives. Its chemical structure allows for compatibility with various substrates, including metals, glass, and ceramics. The presence of phenyl groups contributes to enhanced thermal stability and UV resistance, while the methoxy groups facilitate hydrolysis and subsequent bonding to surfaces. Additionally, this homopolymer can improve the mechanical properties of composite materials, providing increased strength and durability. It is often utilized in applications requiring moisture resistance and chemical durability, making it valuable in industries such as construction, automotive, and electronics. Overall, Phenyltrimethoxysilane homopolymer is recognized for its multifunctional capabilities, contributing to advancements in material science and engineering.
Formula:(C9H14O3Si)x
InChI:InChI=1S/C9H14O3Si/c1-10-13(11-2,12-3)9-7-5-4-6-8-9/h4-8H,1-3H3
InChI key:InChIKey=ZNOCGWVLWPVKAO-UHFFFAOYSA-N
SMILES:[Si](OC)(OC)(OC)C1=CC=CC=C1
Synonyms:- Trimethoxyphenylsilane homopolymer
- Phenyltrimethoxysilane homopolymer
- Benzene, (trimethoxysilyl)-, homopolymer
- Silane, trimethoxyphenyl-, homopolymer
- Poly(phenyltrimethoxysilane)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
