
CAS 89885-27-8
:Silane, hexyltrimethoxy-, homopolymer
Description:
Silane, hexyltrimethoxy-, homopolymer, identified by CAS number 89885-27-8, is a polymeric compound characterized by its silane functional groups. This substance is typically used as a coupling agent or surface modifier due to its ability to enhance adhesion between organic materials and inorganic substrates. The hexyl group contributes to its hydrophobic properties, making it suitable for applications in coatings, sealants, and adhesives where moisture resistance is desired. The presence of trimethoxy groups allows for easy hydrolysis and subsequent bonding to surfaces, facilitating the formation of a stable siloxane network. This polymer exhibits good thermal stability and chemical resistance, which are essential for its performance in various industrial applications. Additionally, it can improve the mechanical properties of composite materials by promoting better interfacial adhesion. Overall, hexyltrimethoxy silane homopolymer is valued for its versatility and effectiveness in enhancing the durability and performance of materials in diverse environments.
Formula:(C9H22O3Si)x
InChI:InChI=1S/C9H22O3Si/c1-5-6-7-8-9-13(10-2,11-3)12-4/h5-9H2,1-4H3
InChI key:InChIKey=CZWLNMOIEMTDJY-UHFFFAOYSA-N
SMILES:[Si](CCCCCC)(OC)(OC)OC
Synonyms:- Silane, hexyltrimethoxy-, homopolymer
- Poly(hexyltrimethoxysilane)
- Hexyltrimethoxysilane-trimethylmethoxysilane copolymer
- KBM 3063 homopolymer
- Hexyltrimethoxysilane homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
