CAS 898911-74-5

N-(Cyclopropylmethyl)cyclopentanamine

Description:

N-(Cyclopropylmethyl)cyclopentanamine is an organic compound characterized by its unique structure, which includes a cyclopropyl group and a cyclopentane ring. This compound features an amine functional group, which contributes to its basicity and potential reactivity. The presence of the cyclopropylmethyl substituent can influence its steric and electronic properties, potentially affecting its interactions with biological targets. Typically, compounds like this may exhibit interesting pharmacological activities, making them of interest in medicinal chemistry. The molecular structure suggests that it may have moderate solubility in organic solvents, while its amine group could impart some degree of solubility in polar solvents. Additionally, the compound's stability and reactivity can be influenced by the strain in the cyclopropyl ring and the overall conformation of the molecule. As with many amines, it may participate in hydrogen bonding, which can affect its boiling and melting points. Overall, N-(Cyclopropylmethyl)cyclopentanamine presents a fascinating subject for further study in both synthetic and applied chemistry contexts.

Formula: C₉H₁₇N

InChI: InChI=1S/C9H17N/c1-2-4-9(3-1)10-7-8-5-6-8/h8-10H,1-7H2

InChI key: InChIKey=CUJOUJDTVQIJRO-UHFFFAOYSA-N

SMILES: C(NC1CCCC1)C2CC2

Synonyms:

• N-(Cyclopropylmethyl)cyclopentanamine
• Cyclopentyl(cyclopropylmethyl)amine
• Cyclopentanamine, N-(cyclopropylmethyl)-