CAS 89892-21-7

6-Bromoquinazoline

Description:

6-Bromoquinazoline is a heterocyclic organic compound characterized by the presence of a bromine atom at the 6-position of the quinazoline ring system. Quinazoline itself is a bicyclic structure composed of a benzene ring fused to a pyrimidine ring. This compound typically exhibits a pale yellow to off-white crystalline appearance and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of the bromine substituent can influence its reactivity and interaction with biological targets. 6-Bromoquinazoline is often utilized in medicinal chemistry as a scaffold for the development of various pharmaceuticals. Its solubility and stability can vary depending on the solvent and conditions, making it important to consider these factors in experimental applications. Additionally, safety data should be reviewed, as halogenated compounds can pose specific hazards. Overall, 6-Bromoquinazoline serves as a valuable compound in research and development within the fields of organic and medicinal chemistry.

Formula: C₈H₅BrN₂

InChI: InChI=1/C8H5BrN2/c9-7-1-2-8-6(3-7)4-10-5-11-8/h1-5H

SMILES: c1cc2c(cc1Br)cncn2

Synonyms:

• Quinazoline, 6-Bromo-

6-Bromoquinazoline

CAS: 89892-21-7

Formula: C₈H₅BrN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 209.0427

Ref: IN-DA006OW5

6-Bromoquinazoline

CAS: 89892-21-7

6-Bromoquinazoline

Purity: 98%

Color and Shape: Solid

Molecular weight: 209.04g/mol

Ref: 54-OR54428

6-Bromoquinazoline

CAS: 89892-21-7

Formula: C₈H₅BrN₂

Purity: >98.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 209.05

Ref: 3B-B6509

6-Bromoquinazoline

CAS: 89892-21-7

Formula: C₈H₅BrN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 209.046

Ref: 10-F048862