CAS 89892-46-6

2-chloro-N-(2,4,6-tribromophenyl)acetamide

Description:

2-Chloro-N-(2,4,6-tribromophenyl)acetamide is a chemical compound characterized by its unique structure, which includes a chloro group and a tribromophenyl moiety attached to an acetamide functional group. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics due to the presence of multiple bromine atoms, which enhance its hydrophobic nature. The presence of the chloro group introduces some polarity, but the overall structure remains predominantly non-polar. It is often used in research and development, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential biological activity. The compound may exhibit antimicrobial or herbicidal properties, making it of interest for various applications. Safety data indicates that it should be handled with care, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be taken during its use and disposal.

Formula: C₈H₅Br₃ClNO

InChI: InChI=1/C8H5Br3ClNO/c9-4-1-5(10)8(6(11)2-4)13-7(14)3-12/h1-2H,3H2,(H,13,14)

Synonyms:

• acetamide, 2-chloro-N-(2,4,6-tribromophenyl)-

2-Chloro-N-(2,4,6-tribromophenyl)acetamide

CAS: 89892-46-6

Versatile small molecule scaffold

Formula: C₈H₅Br₃ClNO

Purity: Min. 95%

Molecular weight: 406.29 g/mol

Ref: 3D-PDA89246