CymitQuimica logo

CAS 89892-81-9

:

1-(Bromomethyl)bicyclo[2.1.1]hexane

Description:
1-(Bromomethyl)bicyclo[2.1.1]hexane is a bicyclic organic compound characterized by its unique structure, which consists of a bicyclo[2.1.1]hexane framework with a bromomethyl group attached to one of the bridgehead carbons. This compound features a bromine atom, which contributes to its reactivity, particularly in nucleophilic substitution reactions. The bicyclic structure imparts rigidity and influences the compound's physical properties, such as boiling and melting points, which are typically higher than those of acyclic compounds due to increased molecular interactions. The presence of the bromomethyl group enhances its utility in organic synthesis, allowing for further functionalization. Additionally, the compound's stereochemistry can lead to interesting conformational dynamics, affecting its reactivity and interactions with other molecules. As with many brominated compounds, it is important to handle 1-(Bromomethyl)bicyclo[2.1.1]hexane with care due to potential toxicity and environmental concerns associated with halogenated organic substances.
Formula:C7H11Br
InChI:InChI=1S/C7H11Br/c8-5-7-2-1-6(3-7)4-7/h6H,1-5H2
InChI key:InChIKey=FUUAMGKQLCKIMV-UHFFFAOYSA-N
SMILES:C(Br)C12CC(C1)CC2
Synonyms:
  • 1-(Bromomethyl)bicyclo[2.1.1]hexane
  • Bicyclo[2.1.1]hexane, 1-(bromomethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.