CymitQuimica logo

CAS 89892-99-9

:

Ethyl 2-bromo-2-methylcyclopropanecarboxylate

Description:
Ethyl 2-bromo-2-methylcyclopropanecarboxylate is an organic compound characterized by its unique cyclopropane structure, which includes a bromine atom and an ethyl ester functional group. The presence of the bromine atom introduces notable reactivity, making it a useful intermediate in various organic synthesis reactions, particularly in nucleophilic substitution and coupling reactions. The cyclopropane ring contributes to the compound's strain, which can influence its reactivity and stability. Ethyl 2-bromo-2-methylcyclopropanecarboxylate is typically a colorless to pale yellow liquid, exhibiting a pleasant odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. This compound is often utilized in the synthesis of more complex molecules in medicinal chemistry and materials science. Safety precautions should be observed when handling this substance, as it may pose health risks due to its bromine content and potential reactivity. Proper storage and disposal methods are essential to mitigate any environmental impact.
Formula:C7H11BrO2
InChI:InChI=1S/C7H11BrO2/c1-3-10-6(9)5-4-7(5,2)8/h5H,3-4H2,1-2H3
InChI key:InChIKey=UGIMXAFCWYSYOZ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1C(Br)(C)C1
Synonyms:
  • Cyclopropanecarboxylic acid, 2-bromo-2-methyl-, ethyl ester
  • NSC 179426
  • Ethyl 2-bromo-2-methylcyclopropanecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.