CAS 89894-77-9
:1-iodo-3-methylcyclohexane
Description:
1-Iodo-3-methylcyclohexane is an organic compound characterized by a cyclohexane ring with a methyl group and an iodine atom attached to it. The presence of the iodine atom introduces significant polarity to the molecule, affecting its reactivity and solubility. This compound is typically a colorless to pale yellow liquid at room temperature, exhibiting a relatively low boiling point compared to other halogenated hydrocarbons. Its structure allows for various stereoisomers due to the cyclohexane's ability to adopt different conformations. The iodine substituent can participate in nucleophilic substitution reactions, making 1-iodo-3-methylcyclohexane a useful intermediate in organic synthesis. Additionally, the compound's properties, such as density and refractive index, are influenced by the presence of the iodine atom and the methyl group. Safety considerations should be taken into account when handling this compound, as iodine is a hazardous material. Overall, 1-iodo-3-methylcyclohexane serves as an important building block in the synthesis of more complex organic molecules.
Formula:C7H13I
InChI:InChI=1/C7H13I/c1-6-3-2-4-7(8)5-6/h6-7H,2-5H2,1H3
Synonyms:- 1-Iodo-3-methylcyclohexane
- cyclohexane, 1-iodo-3-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-Iodo-3-methylcyclohexane
CAS:The synthesis of 1-iodo-3-methylcyclohexane is reported. In this method, chloroamine reacts with transmetallation to form a terminal alkynyl halide. The terminal alkyne can be converted to an iodide by reaction with sodium iodide and then reacted with cyclohexene to produce the desired product. This synthesis is achieved by using a chiral ligand. The reaction mechanism for this process has been determined to be a concerted β-elimination followed by transmetallation.Formula:C7H13IPurity:Min. 95%Molecular weight:224.08 g/mol
