CAS 89898-49-7

1,4-anhydro-3,5-dideoxy-3-(methoxycarbonyl)pent-2-ulose

Description:

1,4-Anhydro-3,5-dideoxy-3-(methoxycarbonyl)pent-2-ulose, with the CAS number 89898-49-7, is a chemical compound characterized by its unique structural features. It belongs to the class of sugar derivatives, specifically an anhydro sugar, which indicates the absence of a water molecule that would typically be present in its hydrated form. The compound contains a pentose backbone, which is a five-carbon sugar, and features both dideoxy and methoxycarbonyl functional groups. The presence of the methoxycarbonyl group suggests that it has potential applications in organic synthesis and medicinal chemistry, as this moiety can enhance the compound's reactivity and solubility. Additionally, the anhydro configuration may impart stability and influence the compound's reactivity in various chemical reactions. Its specific stereochemistry and functional groups contribute to its potential biological activity, making it of interest in research related to carbohydrate chemistry and drug development. Overall, this compound exemplifies the complexity and versatility of sugar derivatives in chemical applications.

Formula: C₇H₁₀O₄

InChI: InChI=1/C7H10O4/c1-4-6(7(9)10-2)5(8)3-11-4/h4,6H,3H2,1-2H3

SMILES: CC1C(C(=O)CO1)C(=O)OC