CymitQuimica logo

CAS 89898-51-1

:

Ethyl 4-oxo-tetrahydrofuran-3-carboxylate

Description:
Ethyl 4-oxo-tetrahydrofuran-3-carboxylate, with the CAS number 89898-51-1, is an organic compound characterized by its tetrahydrofuran ring structure, which includes a carbonyl group (ketone) and a carboxylate ester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water due to its hydrophobic tetrahydrofuran ring. Ethyl 4-oxo-tetrahydrofuran-3-carboxylate is often used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals, owing to its reactivity and ability to participate in further chemical transformations. Its structure allows for potential applications in the development of biologically active molecules. As with many organic compounds, handling should be done with care, following appropriate safety protocols to avoid exposure or adverse reactions.
Formula:C7H10O4
InChI:InChI=1S/C7H10O4/c1-2-11-7(9)5-3-10-4-6(5)8/h5H,2-4H2,1H3
InChI key:BNXOKRMYIMMSKY-UHFFFAOYSA-N
SMILES:CCOC(=O)C1COCC1=O
Found 4 products.