CAS 89921-53-9

Methyl 3-oxabicyclo[3.1.0]hexane-6-carboxylate

Description:

Methyl 3-oxabicyclo[3.1.0]hexane-6-carboxylate, with the CAS number 89921-53-9, is a bicyclic compound characterized by its unique structural framework that includes a bicyclo[3.1.0]hexane core and an ester functional group. This compound features an oxirane (epoxide) ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification and nucleophilic attacks. Methyl 3-oxabicyclo[3.1.0]hexane-6-carboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure allows for interesting stereochemistry, which can influence its physical properties and reactivity. This compound may be of interest in the fields of medicinal chemistry and materials science, where bicyclic structures are often explored for their biological activity and utility in the development of novel compounds.

Formula: C₇H₁₀O₃

InChI: InChI=1S/C7H10O3/c1-9-7(8)6-4-2-10-3-5(4)6/h4-6H,2-3H2,1H3

InChI key: InChIKey=AWKQCWLPOMMURY-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1C2C1COC2

Synonyms:

• 3-Oxabicyclo[3.1.0]hexane-6-carboxylic acid, methyl ester
• 3-Oxabicyclo[3.1.0]hexane-6-carboxylicacid,methylester(7CI)
• Methyl 3-oxabicyclo[3.1.0]hexane-6-carboxylate