
CAS 89924-69-6
:L-Ascorbic acid
Description:
L-Ascorbic acid, commonly known as vitamin C, is a water-soluble vitamin and a potent antioxidant. It plays a crucial role in various biological functions, including collagen synthesis, immune function, and the absorption of iron from plant-based foods. The chemical structure of L-ascorbic acid features a six-carbon lactone ring with multiple hydroxyl (-OH) groups, contributing to its reactivity and solubility in water. It is known for its ability to scavenge free radicals, thereby protecting cells from oxidative stress. L-Ascorbic acid is sensitive to heat, light, and oxygen, which can lead to its degradation, making proper storage essential for maintaining its stability. In addition to its nutritional importance, it is widely used in the food industry as a preservative and in cosmetic formulations for its skin-brightening properties. The CAS number 89924-69-6 specifically identifies a particular form or derivative of L-ascorbic acid, which may have unique characteristics or applications compared to the more commonly referenced form.
Formula:C6H8O6
InChI:InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1
InChI key:InChIKey=CIWBSHSKHKDKBQ-JLAZNSOCSA-N
SMILES:[C@@H](CO)(O)[C@@]1(C(O)=C(O)C(=O)O1)[H]
Synonyms:- Antiscorbic vitamin
- Ascorbajen
- Allercorb
- L-Ascorbic acid
- Antiscorbutic vitamin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.