CAS 89927-09-3

D-arabinose 5-phosphate disodium

Description:

D-arabinose 5-phosphate disodium is a phosphorylated sugar derivative, specifically a sugar phosphate, which plays a role in various biochemical pathways, including nucleotide synthesis and carbohydrate metabolism. As a disodium salt, it is soluble in water, which facilitates its participation in enzymatic reactions within biological systems. The compound is characterized by the presence of a phosphate group attached to the 5-position of the D-arabinose sugar, which contributes to its reactivity and biological function. D-arabinose itself is an aldopentose, meaning it contains five carbon atoms and an aldehyde functional group. The disodium form indicates that two sodium ions are associated with the phosphate group, enhancing its stability and solubility. This compound is often used in research and biochemical applications, particularly in studies related to metabolic pathways and enzyme kinetics. Its role as a substrate or intermediate in various enzymatic reactions underscores its importance in cellular metabolism and biochemistry.

Formula: C₅H₁₁NaO₈P

InChI: InChI=1/C5H11O8P.Na/c6-1-3(7)5(9)4(8)2-13-14(10,11)12;/h1,3-5,7-9H,2H2,(H2,10,11,12);

SMILES: C(=O)C(C(C(COP(=O)(O)O)O)O)O.[Na]

Synonyms:

• Pentose, 5-(Dihydrogen Phosphate), Monosodium Salt

D-Arabinose-5-phosphate disodium salt

CAS: 89927-09-3

Formula: C₅H₉O₈PNa₂

Purity: ≥ 95.0%

Color and Shape: White to off-white powder

Molecular weight: 274.07

Ref: 7W-GC2539

D-Arabinose-5-phosphate disodium salt

CAS: 89927-09-3

D-Arabinose-5-phosphate disodium salt is an inorganic compound that is a substrate for the enzyme, sedoheptulose-7-phosphate (S7P) reductase. D-Arabinose-5-phosphate disodium salt is converted to sedoheptulose 7 phosphate by this enzyme, which participates in the pentose phosphate pathway. This reaction takes place at pH 5.6 and 30°C, with Mn2+ ions as cofactors and a constant of 0.001 M. The time it takes for the reaction to reach equilibrium is about 10 minutes, and the kinetic constant for this reaction is 0.0004 s−1 M−1. D-Arabinose-5-phosphate disodium salt can be prepared through a number of different techniques including ion exchange chromatography or extraction from corn starch using phosphoric acid and hydrochloric acid. It also requires various metal

Formula: C₅H₉Na₂O₈P

Purity: Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 274.07 g/mol

Ref: 3D-MA05068