CAS 89928-06-3
:methyl N-benzoyl-beta-alaninate
Description:
Methyl N-benzoyl-beta-alaninate, with the CAS number 89928-06-3, is an organic compound characterized by its structure, which includes a benzoyl group attached to the nitrogen of beta-alanine, along with a methyl ester functional group. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic benzoyl moiety. Methyl N-benzoyl-beta-alaninate is often studied for its potential applications in pharmaceuticals and as an intermediate in organic synthesis. Its reactivity can be attributed to the presence of both the amine and carboxylic acid functionalities, allowing it to participate in various chemical reactions, including acylation and esterification. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H13NO3
InChI:InChI=1/C11H13NO3/c1-15-10(13)7-8-12-11(14)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,12,14)
SMILES:COC(=O)CCN=C(C1=CC=CC=C1)O
Synonyms:- beta-Alanine, N-benzoyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
