CAS 89929-93-1

(3-furan-2-ylphenyl)methanol

Description:

(3-Furan-2-ylphenyl)methanol, with the CAS number 89929-93-1, is an organic compound characterized by its unique structure, which features a furan ring and a phenyl group connected to a methanol moiety. This compound typically exhibits a white to off-white crystalline appearance. It is soluble in organic solvents, reflecting its hydrophobic nature due to the aromatic components of its structure. The presence of the hydroxyl (-OH) group in the methanol part contributes to its potential as a hydrogen bond donor, which can influence its reactivity and interactions with other molecules. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and materials science. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other functional groups. Overall, (3-furan-2-ylphenyl)methanol is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₁H₁₀O₂

InChI: InChI=1/C11H10O2/c12-8-9-3-1-4-10(7-9)11-5-2-6-13-11/h1-7,12H,8H2

SMILES: c1cc(cc(c1)c1ccco1)CO

Synonyms:

• [3-(2-Furyl)phenyl]methanol
• Benzenemethanol, 3-(2-furanyl)-

[3-(2-Furyl)phenyl]methanol 97%

CAS: 89929-93-1

[3-(2-Furyl)phenyl]methanol 97%

Purity: 97%

Ref: 54-OR9306