
CAS 899357-00-7
:4-Chloro-2-(4-piperidinyl)pyridine
Description:
4-Chloro-2-(4-piperidinyl)pyridine, with the CAS number 899357-00-7, is a chemical compound characterized by its pyridine ring substituted with a chlorine atom and a piperidine group. This compound typically exhibits a pale yellow to off-white solid appearance and is soluble in organic solvents. It possesses a molecular structure that includes a heterocyclic aromatic ring, which contributes to its potential biological activity. The presence of the piperidine moiety may enhance its interaction with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The chlorine substituent can influence the compound's reactivity and lipophilicity, affecting its pharmacokinetic properties. As with many nitrogen-containing heterocycles, it may exhibit basic properties due to the nitrogen atoms in the piperidine and pyridine rings. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, 4-Chloro-2-(4-piperidinyl)pyridine is a compound of interest in various chemical and pharmaceutical applications.
Formula:C10H13ClN2
InChI:InChI=1S/C10H13ClN2/c11-9-3-6-13-10(7-9)8-1-4-12-5-2-8/h3,6-8,12H,1-2,4-5H2
InChI key:InChIKey=XQRKQVMHFDHVJA-UHFFFAOYSA-N
SMILES:ClC=1C=C(N=CC1)C2CCNCC2
Synonyms:- 4-Chloro-2-(4-piperidinyl)pyridine
- Pyridine, 4-chloro-2-(4-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.