
CAS 899359-35-4
:4-(3-Ethyl-4-fluorophenyl)piperidine
Description:
4-(3-Ethyl-4-fluorophenyl)piperidine, with the CAS number 899359-35-4, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a 3-ethyl-4-fluorophenyl substituent, indicating the presence of an ethyl group and a fluorine atom on a phenyl ring. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. The piperidine structure contributes to its potential as a pharmacophore in medicinal chemistry, often associated with various biological activities, including analgesic and psychoactive effects. The compound's molecular structure suggests it may interact with neurotransmitter systems, making it of interest in drug development. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as chromatography. Overall, 4-(3-Ethyl-4-fluorophenyl)piperidine represents a class of compounds that may have significant implications in pharmaceutical research.
Formula:C13H18FN
InChI:InChI=1S/C13H18FN/c1-2-10-9-12(3-4-13(10)14)11-5-7-15-8-6-11/h3-4,9,11,15H,2,5-8H2,1H3
InChI key:InChIKey=SZJZYQASBHHMGR-UHFFFAOYSA-N
SMILES:C(C)C=1C=C(C=CC1F)C2CCNCC2
Synonyms:- Piperidine, 4-(3-ethyl-4-fluorophenyl)-
- 4-(3-Ethyl-4-fluorophenyl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.