CAS 89937-26-8
:1-(6-Chloro-pyridazino-3-yl)-4-hydroxypiperidine
Description:
1-(6-Chloro-pyridazino-3-yl)-4-hydroxypiperidine, with the CAS number 89937-26-8, is a chemical compound characterized by its unique structural features, which include a piperidine ring substituted with a hydroxyl group and a pyridazino moiety. The presence of the chloro group on the pyridazine ring contributes to its reactivity and potential biological activity. This compound may exhibit properties typical of piperidine derivatives, such as being a potential ligand for various biological targets, which could make it of interest in medicinal chemistry. Its hydroxyl group can participate in hydrogen bonding, influencing solubility and interaction with biological systems. The chlorinated pyridazine component may also enhance its pharmacological profile. Overall, this compound's characteristics suggest it could be explored for applications in drug development, particularly in areas targeting neurological or psychiatric conditions, although specific biological activities would require further investigation through experimental studies.
Formula:C9H12ClN3O
InChI:InChI=1/C9H12ClN3O/c10-8-1-2-9(12-11-8)13-5-3-7(14)4-6-13/h1-2,7,14H,3-6H2
SMILES:c1cc(nnc1Cl)N1CCC(CC1)O
Synonyms:- 1-(6-Chloropyridazin-3-yl)piperidin-4-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(6-Chloropyridazin-3-yl)piperidin-4-ol
CAS:Formula:C9H12ClN3OPurity:96%Color and Shape:SolidMolecular weight:213.66411-(6-Chloropyridazin-3-yl)piperidin-4-ol
CAS:1-(6-Chloropyridazin-3-yl)piperidin-4-ol (CPP) is an organic compound that is used as a corrosion inhibitor. It has been shown to be effective in the presence of hydrochloric acid and chloride ions in various media. The mechanism of CPP's anti-corrosion properties is due to its ability to form a protective film on metal surfaces, which can be attributed to its electron donating ability. This film prevents the occurrence of metal dissolution or metal oxidation, thereby preventing corrosion. CPP has been shown to inhibit the growth of bacteria by binding with DNA and RNA. It also inhibits protein synthesis through competitive inhibition of ribosomes.Formula:C9H12ClN3OPurity:(%) Min. 85%Molecular weight:213.66 g/mol1-(6-Chloropyridazin-3-yl)piperidin-4-ol
CAS:Formula:C9H12ClN3OPurity:95.0%Color and Shape:SolidMolecular weight:213.67


