CymitQuimica logo

CAS 89937-49-5

:

2-[1-(propan-2-yl)hydrazinyl]propanoic acid

Description:
2-[1-(Propan-2-yl)hydrazinyl]propanoic acid, with the CAS number 89937-49-5, is an organic compound characterized by the presence of both hydrazine and carboxylic acid functional groups. This compound features a propanoic acid backbone, which contributes to its acidic properties, while the hydrazine moiety introduces potential for reactivity, particularly in forming hydrazones or participating in redox reactions. The isopropyl group attached to the hydrazine nitrogen enhances steric hindrance, which may influence its reactivity and solubility in various solvents. Typically, compounds of this nature are of interest in medicinal chemistry and biochemistry due to their potential biological activities, including anti-inflammatory or antitumor properties. The presence of both hydrazine and carboxylic acid functionalities suggests that it may engage in hydrogen bonding, affecting its physical properties such as melting point and solubility. Overall, 2-[1-(propan-2-yl)hydrazinyl]propanoic acid represents a versatile structure with potential applications in various chemical and pharmaceutical contexts.
Formula:C6H14N2O2
InChI:InChI=1/C6H14N2O2/c1-4(2)8(7)5(3)6(9)10/h4-5H,7H2,1-3H3,(H,9,10)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.