CAS 899374-31-3

2-Amino-4-tricyclo[3.3.1.1^3,7]dec-1-ylphenol

Description:

2-Amino-4-tricyclo[3.3.1.1^3,7]dec-1-ylphenol, with the CAS number 899374-31-3, is a chemical compound characterized by its unique bicyclic structure, which includes a tricyclic framework and an amino group. This compound features a phenolic hydroxyl group, contributing to its potential reactivity and solubility properties. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its interactions in various chemical environments. The tricyclic structure can impart rigidity and specific spatial orientation, which may affect its biological activity and pharmacological properties. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's physical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods, as they can vary significantly based on the molecular structure and functional groups present. Overall, 2-Amino-4-tricyclo[3.3.1.1^3,7]dec-1-ylphenol represents a complex organic molecule with potential significance in various chemical and biological contexts.

Formula: C₁₆H₂₁NO

InChI: InChI=1S/C16H21NO/c17-14-6-13(1-2-15(14)18)16-7-10-3-11(8-16)5-12(4-10)9-16/h1-2,6,10-12,18H,3-5,7-9,17H2

InChI key: InChIKey=SLJXQQVEFXLOAI-UHFFFAOYSA-N

SMILES: NC=1C=C(C23CC4CC(C2)CC(C3)C4)C=CC1O

Synonyms:

• 2-Amino-4-tricyclo[3.3.1.13,7]dec-1-ylphenol
• Phenol, 2-amino-4-tricyclo[3.3.1.13,7]dec-1-yl-

4-(1-Adamantyl)-2-aminophenol

CAS: 899374-31-3

Please enquire for more information about 4-(1-Adamantyl)-2-aminophenol including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₆H₂₁NO

Purity: Min. 95%

Molecular weight: 243.34 g/mol

Ref: 3D-FA120233