CymitQuimica logo

CAS 899374-46-0

:

5-(1H-Imidazol-1-ylmethyl)-2-methoxybenzenamine

Description:
5-(1H-Imidazol-1-ylmethyl)-2-methoxybenzenamine, identified by its CAS number 899374-46-0, is an organic compound characterized by its complex structure that includes an imidazole ring and a methoxy-substituted aniline moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of amino and methoxy functional groups. The imidazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The methoxy group can influence the compound's electronic properties and steric hindrance, affecting its interaction with biological targets. Additionally, the compound may exhibit various physical properties, including melting and boiling points, which are influenced by its molecular structure. Overall, this compound's unique combination of functional groups suggests potential applications in drug discovery and development, particularly in targeting specific biological pathways.
Formula:C11H13N3O
InChI:InChI=1S/C11H13N3O/c1-15-11-3-2-9(6-10(11)12)7-14-5-4-13-8-14/h2-6,8H,7,12H2,1H3
InChI key:InChIKey=PEUFEMKFOLDJLK-UHFFFAOYSA-N
SMILES:C(C1=CC(N)=C(OC)C=C1)N2C=CN=C2
Synonyms:
  • 5-(1H-Imidazol-1-ylmethyl)-2-methoxybenzenamine
  • Benzenamine, 5-(1H-imidazol-1-ylmethyl)-2-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.