CAS 89939-59-3
:1H-Indazole-3-carbonitrile,5-amino-
Description:
1H-Indazole-3-carbonitrile,5-amino- is an organic compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a carbonitrile group (-C≡N) at the 3-position and an amino group (-NH2) at the 5-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its functional groups suggest that it could participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it of interest in the synthesis of pharmaceuticals or agrochemicals. Additionally, the compound may possess biological activity, which warrants further investigation for potential therapeutic uses. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, influencing its behavior in chemical reactions and interactions with biological targets.
Formula:C8H6N4
InChI:InChI=1S/C8H6N4/c9-4-8-6-3-5(10)1-2-7(6)11-12-8/h1-3H,10H2,(H,11,12)
InChI key:KGEYZMRZVKMQBY-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1N)C(=NN2)C#N
Synonyms:- 5-Amino-3-cyano-1H-indazole
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
