
CAS 89942-32-5
:1-(4-Hydroxy-2-iodophenyl)ethanone
Description:
1-(4-Hydroxy-2-iodophenyl)ethanone, with the CAS number 89942-32-5, is an organic compound characterized by its functional groups and structural features. It contains a phenolic hydroxyl group and an iodo substituent on the aromatic ring, which can influence its reactivity and solubility. The presence of the ethanone (acetyl) group contributes to its ketone functionality, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. This compound may exhibit biological activity due to the hydroxyl and iodo groups, which can affect its interaction with biological systems. Additionally, its molecular structure suggests that it may have applications in pharmaceuticals or as an intermediate in organic synthesis. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, 1-(4-Hydroxy-2-iodophenyl)ethanone is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C8H7IO2
InChI:InChI=1S/C8H7IO2/c1-5(10)7-3-2-6(11)4-8(7)9/h2-4,11H,1H3
InChI key:InChIKey=CUJXMENEPQIOCB-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(I)C=C(O)C=C1
Synonyms:- Ethanone, 1-(4-hydroxy-2-iodophenyl)-
- 1-(4-Hydroxy-2-iodophenyl)ethanone
- Acetophenone, 4′-hydroxy-2′-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.