CAS 89942-34-7

4-iodo-2-methoxybenzoic acid

Description:

4-Iodo-2-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of an iodine atom and a methoxy group on a benzene ring. The molecular structure features a benzoic acid core, with the iodine substituent located at the para position (4-position) and a methoxy group at the ortho position (2-position) relative to the carboxylic acid group. This compound typically exhibits moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic structure. Its chemical properties include the ability to undergo typical electrophilic aromatic substitution reactions, as well as potential reactivity in nucleophilic substitution due to the presence of the iodine atom. The methoxy group can influence the electronic properties of the molecule, making it a useful intermediate in organic synthesis and medicinal chemistry. Additionally, the compound may exhibit biological activity, which can be explored in various research contexts. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₈H₇IO₃

InChI: InChI=1/C8H7IO3/c1-12-7-4-5(9)2-3-6(7)8(10)11/h2-4H,1H3,(H,10,11)

SMILES: COc1cc(ccc1C(=O)O)I

4-IODO-2-METHOXYBENZOIC ACID

CAS: 89942-34-7

Formula: C₈H₇IO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 278.0438

Ref: IN-DA003LKA

4-Iodo-2-methoxybenzoic acid

CAS: 89942-34-7

4-Iodo-2-methoxybenzoic acid

Formula: C₈H₇IO₃

Purity: ≥95%

Color and Shape: white solid

Molecular weight: 278.04g/mol

Ref: 54-OR345152

4-Iodo-2-methoxybenzoic acid

CAS: 89942-34-7

4-Iodo-2-methoxybenzoic acid is an organic compound that contains a carbonyl group and a copper chelate. It has been shown to be stable in the presence of mercapto, chloroform, and palladium. The chemical structures of 4-iodo-2-methoxybenzoic acid are different from those of other compounds because it contains a chelate ring. Experiments have shown that extracts containing 4-iodo-2-methoxybenzoic acid are more extractable than those without it. This is due to the chelate ring which can act as an ion exchange group, allowing for the extraction of charged ions from the solution.

Formula: C₈H₇IO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 278.04 g/mol

Ref: 3D-FI67305

4-Iodo-2-methoxybenzoic acid

CAS: 89942-34-7

Formula: C₈H₇IO₃

Purity: 95%

Molecular weight: 278.045

Ref: 10-F464060