CAS 89942-77-8

Methyl 3-hydroxy-2-nitrobenzoate

Description:

Methyl 3-hydroxy-2-nitrobenzoate, with the CAS number 89942-77-8, is an organic compound that belongs to the class of benzoates. It features a methyl ester functional group, a hydroxyl group, and a nitro group, which contribute to its chemical properties and reactivity. The presence of the hydroxyl group indicates that it can participate in hydrogen bonding, potentially affecting its solubility in polar solvents. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity in electrophilic aromatic substitution reactions. Methyl 3-hydroxy-2-nitrobenzoate may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure suggests it could be used as an intermediate in the synthesis of more complex organic molecules. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial applications.

Formula: C₈H₇NO₅

InChI: InChI=1/C8H7NO5/c1-14-8(11)5-3-2-4-6(10)7(5)9(12)13/h2-4,10H,1H3

SMILES: COC(=O)c1cccc(c1N(=O)=O)O

Synonyms:

• Benzoic acid, 3-hydroxy-2-nitro-, methyl ester

Methyl 3-hydroxy-2-nitrobenzoate

CAS: 89942-77-8

Methyl 3-hydroxy-2-nitrobenzoate

Formula: C₈H₇NO₅

Purity: 97%

Color and Shape: off white solid

Molecular weight: 197.14g/mol

Ref: 54-OR70011

Methyl 3-hydroxy-2-nitrobenzoate

CAS: 89942-77-8

Formula: C₈H₇NO₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 197.146

Ref: 10-F234156

Methyl 3-hydroxy-2-nitrobenzoate

CAS: 89942-77-8

Formula: C₈H₇NO₅

Purity: 96%

Color and Shape: Solid

Molecular weight: 197.1449

Ref: IN-DA00356Y