CymitQuimica logo

CAS 89943-13-5

:

3-ethoxypyridin-4-amine

Description:
3-Ethoxypyridin-4-amine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an ethoxy group (-OCH2CH3) at the 3-position and an amino group (-NH2) at the 4-position of the pyridine ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. It may exhibit basic properties due to the nitrogen atom in the amino group, allowing it to act as a weak base. 3-Ethoxypyridin-4-amine can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in synthetic organic chemistry and potentially in pharmaceutical applications. Its specific reactivity and applications would depend on the functional groups present and the overall molecular structure. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H10N2O
InChI:InChI=1S/C7H10N2O/c1-2-10-7-5-9-4-3-6(7)8/h3-5H,2H2,1H3,(H2,8,9)
InChI key:QNDMDMFWRZOZEB-UHFFFAOYSA-N
SMILES:CCOC1=C(C=CN=C1)N
Found 4 products.