CAS 89943-20-4

2-Cyano-3-ethoxy-2-butenethioamide

Description:

2-Cyano-3-ethoxy-2-butenethioamide is an organic compound characterized by its unique functional groups, including a cyano group, an ethoxy group, and a thioamide moiety. This compound features a butenyl backbone, which contributes to its reactivity and potential applications in organic synthesis. The presence of the cyano group indicates that it can participate in nucleophilic reactions, while the thioamide functionality may enhance its ability to form coordination complexes with metals. The ethoxy group adds to the compound's solubility in organic solvents and may influence its physical properties, such as boiling and melting points. Additionally, the structural arrangement of the substituents can affect the compound's stereochemistry and reactivity patterns. Overall, 2-Cyano-3-ethoxy-2-butenethioamide is of interest in various fields, including medicinal chemistry and materials science, due to its potential as a building block for more complex molecules. Its specific applications and behavior would depend on the context of its use and the conditions under which it is studied.

Formula: C₇H₁₀N₂OS

InChI: InChI=1S/C7H10N2OS/c1-3-10-5(2)6(4-8)7(9)11/h3H2,1-2H3,(H2,9,11)

InChI key: InChIKey=QRQWVBSLABMWFN-UHFFFAOYSA-N

SMILES: C(=C(OCC)C)(C(N)=S)C#N

Synonyms:

• Crotonamide, 2-cyano-3-ethoxythio-
• 2-Cyano-3-ethoxythiocrotonamide
• NSC 521450
• 2-Butenethioamide, 2-cyano-3-ethoxy-
• 2-Cyano-3-ethoxy-2-butenethioamide

2-Cyano-3-ethoxybut-2-enethioamide

CAS: 89943-20-4

Formula: C₇H₁₀N₂OS

Molecular weight: 170.2321

Ref: IN-DA00H4HF