CymitQuimica logo

CAS 899436-71-6

:

2-methylpyridine-3-boronic acid

Description:
2-Methylpyridine-3-boronic acid, with the CAS number 899436-71-6, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring. This compound features a methyl group at the second position and a boronic acid group at the third position of the pyridine ring, which contributes to its reactivity and utility in various chemical reactions, particularly in Suzuki coupling reactions for the formation of carbon-carbon bonds. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which enhances its applicability in aqueous environments. The boronic acid functionality allows for the formation of reversible complexes with diols, making it useful in sensing applications and in the development of drug delivery systems. Additionally, 2-methylpyridine-3-boronic acid can serve as a building block in organic synthesis, particularly in the pharmaceutical industry, due to its ability to participate in diverse chemical transformations.
Formula:C6H8BNO2
InChI:InChI=1/C6H8BNO2/c1-5-6(7(9)10)3-2-4-8-5/h2-4,9-10H,1H3
InChI key:TWKMYNQPIICYNV-UHFFFAOYSA-N
SMILES:Cc1c(cccn1)B(O)O
Synonyms:
  • 2-Methyl-3-pyridinylboronic acid
Found 4 products.