
CAS 899436-84-1
:B-[5-(2-Piperidinyl)-3-pyridinyl]boronic acid
Description:
B-[5-(2-Piperidinyl)-3-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a pyridine ring substituted with a piperidine moiety, contributing to its potential biological activity and interactions. The boronic acid group imparts unique reactivity, making it useful in various applications, including medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound may exhibit properties such as solubility in polar solvents, moderate stability under standard conditions, and the ability to participate in Suzuki coupling reactions, which are valuable in organic synthesis. Its structural characteristics suggest potential applications in drug discovery, especially in the context of targeting enzymes or receptors involved in disease processes. As with many boronic acids, careful handling is required due to their sensitivity to moisture and air, which can affect their stability and reactivity.
Formula:C10H15BN2O2
InChI:InChI=1S/C10H15BN2O2/c14-11(15)9-5-8(6-12-7-9)10-3-1-2-4-13-10/h5-7,10,13-15H,1-4H2
InChI key:InChIKey=NZHNZCDYQXPJAU-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC(=CN=C1)C2CCCCN2
Synonyms:- [5-(Piperidin-2-yl)pyridin-3-yl]boronic acid
- Boronic acid, [5-(2-piperidinyl)-3-pyridinyl]-
- B-[5-(2-Piperidinyl)-3-pyridinyl]boronic acid
- Boronic acid, B-[5-(2-piperidinyl)-3-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(piperidin-2-yl)pyridin-3-ylboronicacidhydrochloride
CAS:Formula:C10H15BN2O2Molecular weight:206.0493
