CymitQuimica logo

CAS 89948-18-5

:

(9xi,11beta,17alpha)-17-(ethylsulfanyl)-9-fluoro-17-[(2-fluoroethyl)sulfanyl]-11-hydroxyandrosta-1,4-dien-3-one

Description:
The chemical substance known as "(9xi,11beta,17alpha)-17-(ethylsulfanyl)-9-fluoro-17-[(2-fluoroethyl)sulfanyl]-11-hydroxyandrosta-1,4-dien-3-one," with the CAS number 89948-18-5, is a synthetic steroid derivative. It features a complex structure characterized by multiple functional groups, including fluorine and sulfur substituents, which contribute to its unique chemical properties. The presence of the fluoro groups typically enhances the compound's lipophilicity and metabolic stability, potentially influencing its biological activity. The hydroxyl group at the 11-position may impart additional reactivity and solubility characteristics. This compound is likely to exhibit specific interactions with biological targets, making it of interest in pharmacological research, particularly in the fields of endocrinology and oncology. Its structural modifications suggest potential applications in therapeutic contexts, although detailed studies would be necessary to elucidate its pharmacodynamics and pharmacokinetics. As with many synthetic steroids, careful consideration of its safety profile and regulatory status is essential for any practical applications.
Formula:C23H32F2O2S2
InChI:InChI=1/C23H32F2O2S2/c1-4-28-22(29-12-11-24)10-8-17-18-6-5-15-13-16(26)7-9-20(15,2)23(18,25)19(27)14-21(17,22)3/h7,9,13,17-19,27H,4-6,8,10-12,14H2,1-3H3/t17-,18-,19-,20-,21-,22-,23?/m0/s1
SMILES:CCS[C@@]1(CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)C3([C@H](C[C@]12C)O)F)SCCF
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.