CAS 89951-56-4

(5-amino-2-chlorophenyl)methanol

Description:

(5-amino-2-chlorophenyl)methanol, with the CAS number 89951-56-4, is an organic compound characterized by the presence of an amino group and a chlorophenyl moiety. This compound features a hydroxymethyl group (-CH2OH) attached to a chlorinated aromatic ring, which contributes to its reactivity and potential applications in various chemical reactions. The amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents, while the chlorophenyl structure may influence its electronic properties and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis typically involves the introduction of the amino and hydroxymethyl groups onto the aromatic ring, which can be achieved through various organic synthesis methods. The presence of both the amino and hydroxymethyl functionalities suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₇H₈ClNO

InChI: InChI=1/C7H8ClNO/c8-7-2-1-6(9)3-5(7)4-10/h1-3,10H,4,9H2

SMILES: c1cc(c(cc1N)CO)Cl

Synonyms:

• 5-Amino-2-chlorobenzyl alcohol

(5-Amino-2-chlorophenyl)methanol

CAS: 89951-56-4

Formula: C₇H₈ClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 157.5975

Ref: IN-DA00346Q

(5-Amino-2-chlorophenyl)methanol

CAS: 89951-56-4

(5-Amino-2-chlorophenyl)methanol

Purity: 97%

Molecular weight: 157.60g/mol

Ref: 54-OR90049

(5-Amino-2-chlorophenyl)methanol

CAS: 89951-56-4

Formula: C₇H₈ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 157.6

Ref: 10-F092265