CAS 89951-79-1

(4'-methylbiphenyl-3-yl)methanol

Description:

(4'-Methylbiphenyl-3-yl)methanol, with the CAS number 89951-79-1, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methyl group at the para position of one phenyl ring and a hydroxymethyl group (-CH2OH) at the meta position of the other phenyl ring contributes to its unique chemical properties. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic nature due to the aromatic rings. Its molecular structure suggests potential applications in organic synthesis, as well as in the development of pharmaceuticals and agrochemicals. The hydroxymethyl group can participate in various chemical reactions, such as oxidation or esterification, making it a versatile intermediate in organic chemistry. Additionally, the compound's physical and chemical properties, such as melting point and boiling point, can vary based on purity and environmental conditions.

Formula: C₁₄H₁₄O

InChI: InChI=1/C14H14O/c1-11-5-7-13(8-6-11)14-4-2-3-12(9-14)10-15/h2-9,15H,10H2,1H3

SMILES: Cc1ccc(cc1)c1cccc(c1)CO

Synonyms:

• [1,1'-Biphenyl]-3-methanol, 4'-methyl-
• (4'-Methylbiphenyl-3-yl)methanol

(4'-Methylbiphenyl-3-yl)-methanol

CAS: 89951-79-1

Formula: C₁₄H₁₄O

Purity: 96%

Molecular weight: 198.2604

Ref: IN-DA006NFW

(4'-Methyl-[1,1'-biphenyl]-3-yl)methanol

CAS: 89951-79-1

(4'-Methyl-[1,1'-biphenyl]-3-yl)methanol

Purity: ≥95%

Molecular weight: 198.26g/mol

Ref: 54-OR303368

(4′-Methyl[1,1′-biphenyl]-3-yl)methanol

CAS: 89951-79-1

Formula: C₁₄H₁₄O

Purity: 95.0%

Molecular weight: 198.265

Ref: 10-F039908