CymitQuimica logo

CAS 89967-02-2

:

2-Methyl-4-propylpyrimidine

Description:
2-Methyl-4-propylpyrimidine is an organic compound belonging to the pyrimidine family, characterized by a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a methyl group at the second carbon and a propyl group at the fourth carbon of the pyrimidine ring, contributing to its unique structural properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of alkyl substituents influences its solubility, making it more soluble in organic solvents than in water. 2-Methyl-4-propylpyrimidine may exhibit biological activity, which can be of interest in pharmaceutical research, particularly in the development of new drugs or agrochemicals. Its chemical properties, such as boiling point, melting point, and reactivity, are influenced by the functional groups present and the overall molecular structure. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H12N2
InChI:InChI=1S/C8H12N2/c1-3-4-8-5-6-9-7(2)10-8/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=LLHIRDBBLFSHNW-UHFFFAOYSA-N
SMILES:C(CC)C1=NC(C)=NC=C1
Synonyms:
  • Pyrimidine, 2-methyl-4-propyl-
  • 2-Methyl-4-propylpyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.