CAS 89967-18-0
:2-methyl-6-propylpyrimidin-4-ol
Description:
2-Methyl-6-propylpyrimidin-4-ol is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a hydroxyl group (-OH) at the 4-position contributes to its classification as an alcohol. The substituents, a methyl group at the 2-position and a propyl group at the 6-position, influence its physical and chemical properties, including solubility and reactivity. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests it could participate in hydrogen bonding due to the hydroxyl group, affecting its interactions in various environments. Additionally, the presence of alkyl groups can enhance lipophilicity, impacting its distribution in biological systems. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its stability and potential toxicity.
Formula:C8H12N2O
InChI:InChI=1/C8H12N2O/c1-3-4-7-5-8(11)10-6(2)9-7/h5H,3-4H2,1-2H3,(H,9,10,11)
SMILES:CCCc1cc(nc(C)n1)O
Synonyms:- 4-Propyl-6-hydroxy-2-methylpyrimidine
- 4-Pyrimidinol, 2-Methyl-6-Propyl-
- 2-Methyl-6-propylpyrimidin-4-ol
- 2-Methyl-6-propyl-3,4-dihydropyrimidin-4-one
- 4(3H)-Pyrimidinone, 2-methyl-6-propyl-
- 4-Hydroxy-2-methyl-6-(n-propyl)pyrimidine
- 2-methyl-6-propyl-4(3H)-Pyrimidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.