CAS 899710-21-5
:5-[[[(2-Fluorophenyl)methyl]sulfonyl]methyl]-2-furancarboxylic acid
Description:
5-[[[(2-Fluorophenyl)methyl]sulfonyl]methyl]-2-furancarboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring, a carboxylic acid functional group, and a sulfonyl group attached to a fluorophenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential solubility in organic solvents and moderate polarity due to the presence of the carboxylic acid. The fluorine atom in the 2-fluorophenyl group can influence the compound's electronic properties, potentially enhancing its reactivity and biological activity. The sulfonyl group may contribute to the compound's ability to form hydrogen bonds, affecting its interactions in biological systems. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential pharmacological properties. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C13H11FO5S
InChI:InChI=1S/C13H11FO5S/c14-11-4-2-1-3-9(11)7-20(17,18)8-10-5-6-12(19-10)13(15)16/h1-6H,7-8H2,(H,15,16)
InChI key:InChIKey=LQFKQJUZZCYZTB-UHFFFAOYSA-N
SMILES:C(S(CC1=C(F)C=CC=C1)(=O)=O)C=2OC(C(O)=O)=CC2
Synonyms:- 2-Furancarboxylic acid, 5-[[[(2-fluorophenyl)methyl]sulfonyl]methyl]-
- 5-[[[(2-Fluorophenyl)methyl]sulfonyl]methyl]-2-furancarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.