CAS 899710-26-0

5-[(Dibutylamino)methyl]-2-furancarboxylic acid hydrazide

Description:

5-[(Dibutylamino)methyl]-2-furancarboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a furan ring, a hydrazide functional group, and a dibutylamino substituent. This compound typically exhibits properties associated with both hydrazides and furan derivatives, such as potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of the hydrazide moiety. It may also display moderate solubility in organic solvents, influenced by the hydrophobic dibutylamino groups. The presence of the furan ring can impart aromatic characteristics, potentially affecting its stability and reactivity under various conditions. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing other complex molecules. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure levels.

Formula: C₁₄H₂₅N₃O₂

InChI: InChI=1S/C14H25N3O2/c1-3-5-9-17(10-6-4-2)11-12-7-8-13(19-12)14(18)16-15/h7-8H,3-6,9-11,15H2,1-2H3,(H,16,18)

InChI key: InChIKey=YNEBEZZMSJZKPG-UHFFFAOYSA-N

SMILES: C(NN)(=O)C=1OC(CN(CCCC)CCCC)=CC1

Synonyms:

• 5-[(Dibutylamino)methyl]-2-furancarboxylic acid hydrazide
• 2-Furancarboxylic acid, 5-[(dibutylamino)methyl]-, hydrazide