CAS 899710-42-0
:3-Nitro-5-[(3-phenylpropyl)thio]benzenamine
Description:
3-Nitro-5-[(3-phenylpropyl)thio]benzenamine, with the CAS number 899710-42-0, is an organic compound characterized by its aromatic structure, which includes a nitro group and a thioether functional group. The presence of the nitro group (-NO2) indicates that it is a nitroaromatic compound, which can exhibit unique reactivity and properties, such as potential electrophilic substitution reactions. The thioether group, derived from the phenylpropyl moiety, contributes to the compound's overall hydrophobic character and can influence its solubility and interaction with biological systems. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in various fields, including pharmaceuticals and materials science. However, specific safety and handling information should be consulted, as nitro compounds can pose health risks and environmental concerns. Overall, 3-Nitro-5-[(3-phenylpropyl)thio]benzenamine represents a complex organic molecule with diverse chemical properties and potential applications.
Formula:C15H16N2O2S
InChI:InChI=1S/C15H16N2O2S/c16-13-9-14(17(18)19)11-15(10-13)20-8-4-7-12-5-2-1-3-6-12/h1-3,5-6,9-11H,4,7-8,16H2
InChI key:InChIKey=VXWWJBQNXCOYDB-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC(SCCCC2=CC=CC=C2)=CC(N)=C1
Synonyms:- 3-Nitro-5-[(3-phenylpropyl)thio]benzenamine
- Benzenamine, 3-nitro-5-[(3-phenylpropyl)thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.