CAS 899718-22-0
:4-[[(1-Acetyl-2,3-dihydro-1H-indol-5-yl)sulfonyl]amino]butanoic acid
Description:
4-[[(1-Acetyl-2,3-dihydro-1H-indol-5-yl)sulfonyl]amino]butanoic acid, with the CAS number 899718-22-0, is a synthetic organic compound characterized by its complex structure, which includes an indole moiety, a sulfonamide group, and a carboxylic acid functional group. This compound typically exhibits properties associated with both sulfonamides and amino acids, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the carboxylic acid and amine functionalities. The indole ring contributes to its aromatic character, which may influence its biological activity and interactions. The acetyl group can enhance lipophilicity, potentially affecting its pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its unique structural features suggest potential applications in drug design, especially in areas related to neuropharmacology or anti-inflammatory therapies. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C14H18N2O5S
InChI:InChI=1S/C14H18N2O5S/c1-10(17)16-8-6-11-9-12(4-5-13(11)16)22(20,21)15-7-2-3-14(18)19/h4-5,9,15H,2-3,6-8H2,1H3,(H,18,19)
InChI key:InChIKey=GANNFJBGJOCEIL-UHFFFAOYSA-N
SMILES:C(C)(=O)N1C=2C(=CC(S(NCCCC(O)=O)(=O)=O)=CC2)CC1
Synonyms:- Butanoic acid, 4-[[(1-acetyl-2,3-dihydro-1H-indol-5-yl)sulfonyl]amino]-
- 4-[[(1-Acetyl-2,3-dihydro-1H-indol-5-yl)sulfonyl]amino]butanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.