CAS 89976-12-5
:2-Methyl-5-nitrobenzotrifluoride
Description:
2-Methyl-5-nitrobenzotrifluoride, with the CAS number 89976-12-5, is an aromatic compound characterized by the presence of a methyl group, a nitro group, and three fluorine atoms attached to a benzene ring. This compound typically exhibits a pale yellow to light brown appearance and is known for its relatively low volatility and high stability under standard conditions. It is a polar molecule due to the electronegative fluorine and nitro groups, which can influence its solubility in various solvents. The presence of the nitro group imparts certain reactivity, making it a potential candidate for further chemical transformations. Additionally, the trifluoromethyl groups enhance its lipophilicity, which can affect its behavior in biological systems and environmental interactions. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 2-Methyl-5-nitrobenzotrifluoride is of interest in various fields, including organic synthesis and materials science, due to its unique structural features and properties.
Formula:C8H6F3NO2
InChI:InChI=1/C8H6F3NO2/c1-5-2-3-6(12(13)14)4-7(5)8(9,10)11/h2-4H,1H3
SMILES:Cc1ccc(cc1C(F)(F)F)N(=O)=O
Synonyms:- 1-Methyl-4-nitro-2-(trifluoromethyl)benzene
- Benzene, 1-Methyl-4-Nitro-2-(Trifluoromethyl)-
- 4-Nitro-2-Trifluorotoluene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Methyl-5-nitrobenzotrifluoride
CAS:Formula:C8H6F3NO2Purity:>98.0%(GC)Color and Shape:White or Colorless to Yellow powder to lump to clear liquidMolecular weight:205.142-Methyl-5-nitrobenzotrifluoride, 98%
CAS:<p>Employed as an important intermediate for raw material for organic synthesis, agrochemical, pharmaceutical and dyestuff field This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand</p>Formula:C8H6F3NO2Purity:98%Molecular weight:205.141-Methyl-4-nitro-2-(trifluoromethyl)benzene
CAS:Formula:C8H6F3NO2Purity:97%Color and Shape:SolidMolecular weight:205.13392-Methyl-5-nitrobenzotrifluoride
CAS:<p>2-Methyl-5-nitrobenzotrifluoride</p>Formula:C8H6F3NO2Purity:≥95%Color and Shape:PowderMolecular weight:205.13g/mol4-NITRO-2-TRIFLUOROMETHYLTOLUENE
CAS:Formula:C8H6F3NO2Purity:95%Color and Shape:SolidMolecular weight:205.136





