
CAS 89977-47-9
:5,7-Quinoxalinediamine
Description:
5,7-Quinoxalinediamine, with the CAS number 89977-47-9, is an organic compound characterized by its bicyclic structure, which consists of a quinoxaline core with two amino groups at the 5 and 7 positions. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. It exhibits properties such as solubility in polar solvents, which can vary depending on the specific formulation and conditions. The presence of amino groups contributes to its reactivity, allowing it to participate in various chemical reactions, including those involving nucleophilic substitution and coupling reactions. Additionally, 5,7-Quinoxalinediamine may exhibit biological activity, making it of interest for research in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, its unique structure and functional groups make it a compound of interest in both synthetic and applied chemistry.
Formula:C8H8N4
InChI:InChI=1S/C8H8N4/c9-5-3-6(10)8-7(4-5)11-1-2-12-8/h1-4H,9-10H2
InChI key:InChIKey=ZAHKHGUSQBWDFQ-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=C(N)C1)N=CC=N2
Synonyms:- 5,7-Quinoxalinediamine
- Quinoxaline, 5,7-diamino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.