
CAS 89978-93-8
:3-Chloro-4-methoxybenzamide
Description:
3-Chloro-4-methoxybenzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom and a methoxy group, as well as an amide functional group. The presence of the chlorine atom at the meta position relative to the amide group and the methoxy group at the para position influences its chemical reactivity and physical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the aromatic ring and the methoxy group. It can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in synthetic organic chemistry. Additionally, the compound may exhibit biological activity, which can be explored in pharmaceutical research. Its molecular structure contributes to its potential applications in drug development and as an intermediate in the synthesis of other chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H8ClNO2
InChI:InChI=1S/C8H8ClNO2/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4H,1H3,(H2,10,11)
InChI key:InChIKey=LDYSKQBCMXRUGA-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(Cl)=C(OC)C=C1
Synonyms:- p-Anisamide, 3-chloro-
- 3-Chloro-4-methoxybenzamide
- 3-Chloro-4-methoxy-benzoic acid amide
- Benzamide, 3-chloro-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.