CAS 89979-06-6

1-chloro-4-ethoxy-2-nitrobenzene

Description:

1-Chloro-4-ethoxy-2-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom, an ethoxy group, and a nitro group. The presence of the nitro group (-NO2) introduces significant polarity and reactivity, making this compound a potential candidate for various chemical reactions, including electrophilic substitution. The ethoxy group (-OCH2CH3) contributes to the compound's solubility in organic solvents and can influence its reactivity and stability. The chlorine atom serves as a good leaving group in nucleophilic substitution reactions. This compound is typically used in organic synthesis and may have applications in the development of pharmaceuticals or agrochemicals. Its physical properties, such as boiling point and melting point, are influenced by the functional groups present and the overall molecular structure. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of the nitro group and chlorine atom.

Formula: C₈H₈ClNO₃

InChI: InChI=1/C8H8ClNO3/c1-2-13-6-3-4-7(9)8(5-6)10(11)12/h3-5H,2H2,1H3

SMILES: CCOc1ccc(c(c1)N(=O)=O)Cl

1-Chloro-4-ethoxy-2-nitrobenzene

CAS: 89979-06-6

Versatile small molecule scaffold

Formula: C₈H₈ClNO₃

Purity: Min. 95%

Molecular weight: 201.61 g/mol

Ref: 3D-PDA97906