CAS 89979-14-6

2-Chloro-1-(ethylsulfonyl)-4-nitrobenzene

Description:

2-Chloro-1-(ethylsulfonyl)-4-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a nitro group and a chloro substituent on a benzene ring. The presence of the ethylsulfonyl group contributes to its unique chemical properties, enhancing its solubility in polar solvents. This compound typically exhibits a yellow to brown color and is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its molecular structure suggests it may participate in electrophilic substitution reactions due to the electron-withdrawing nature of the nitro group and the electron-donating characteristics of the sulfonyl group. Additionally, the chloro substituent can facilitate nucleophilic substitution reactions. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate any risks associated with its use.

Formula: C₈H₈ClNO₄S

InChI: InChI=1S/C8H8ClNO4S/c1-2-15(13,14)8-4-3-6(10(11)12)5-7(8)9/h3-5H,2H2,1H3

InChI key: InChIKey=WDCLGGYMVLPIHI-UHFFFAOYSA-N

SMILES: S(CC)(=O)(=O)C1=C(Cl)C=C(N(=O)=O)C=C1

Synonyms:

• Sulfone, 2-chloro-4-nitrophenyl ethyl
• 2-Chloro-1-(ethanesulfonyl)-4-nitrobenzene
• 2-Chloro-1-(ethylsulfonyl)-4-nitrobenzene
• Benzene, 2-chloro-1-(ethylsulfonyl)-4-nitro-