CAS 899828-53-6

N-[(pentafluorobenzyl)oxy]propan-2-imine

Description:

N-[(pentafluorobenzyl)oxy]propan-2-imine is a chemical compound characterized by its unique structure, which includes a pentafluorobenzyl group and an imine functional group. The presence of the pentafluorobenzyl moiety imparts significant fluorine content, which can enhance the compound's lipophilicity and stability, making it of interest in various chemical applications, including pharmaceuticals and materials science. The imine functional group, characterized by a carbon-nitrogen double bond, contributes to the compound's reactivity, allowing for potential participation in nucleophilic addition reactions. This compound is likely to exhibit distinct physical properties, such as a high boiling point and low solubility in water, due to the electronegative fluorine atoms. Additionally, the presence of multiple fluorine atoms can influence the compound's electronic properties, potentially affecting its behavior in biological systems or its interaction with other chemical species. Overall, N-[(pentafluorobenzyl)oxy]propan-2-imine represents a complex and intriguing molecule with potential applications in various fields of chemistry.

Formula: C₁₀H₈F₅NO

InChI: InChI=1/C10H8F5NO/c1-4(2)16-17-3-5-6(11)8(13)10(15)9(14)7(5)12/h3H2,1-2H3

SMILES: CC(=NOCc1c(c(c(c(c1F)F)F)F)F)C

2-Propanone, O-[(2,3,4,5,6-pentafluorophenyl)methyl]oxime

CAS: 899828-53-6

Formula: C₁₀H₈F₅NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 253.1686

Ref: IN-DA003ALO

2-PRopanone, O-[(2,3,4,5,6-pentafluorophenyl)methyl]oxime

CAS: 899828-53-6

2-PRopanone, O-[(2,3,4,5,6-pentafluorophenyl)methyl]oxime

Purity: 95%

Molecular weight: 253.17g/mol

Ref: 54-PC1002934

2-PRopanone, O-[(2,3,4,5,6-pentafluorophenyl)methyl]oxime

CAS: 899828-53-6

Purity: 95%

Molecular weight: 253.1719971

Ref: 10-F633899