CAS 89984-45-2

3-(morpholin-4-yl)-3-oxopropanethioamide

Description:

3-(Morpholin-4-yl)-3-oxopropanethioamide, with the CAS number 89984-45-2, is a chemical compound characterized by its unique structural features. It contains a morpholine ring, which is a six-membered heterocyclic amine, contributing to its potential biological activity. The compound features a thioamide functional group, which is known for its reactivity and ability to form hydrogen bonds, enhancing its interactions in biological systems. The presence of a ketone group adjacent to the thioamide adds to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic attacks. This compound may exhibit properties such as solubility in polar solvents, and its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the morpholine moiety may impart specific pharmacological properties, making it of interest in drug design and synthesis. Overall, 3-(morpholin-4-yl)-3-oxopropanethioamide is a compound with diverse chemical characteristics that could be explored for various applications in research and industry.

Formula: C₇H₁₂N₂O₂S

InChI: InChI=1/C7H12N2O2S/c8-6(12)5-7(10)9-1-3-11-4-2-9/h1-5H2,(H2,8,12)

SMILES: C1COCCN1C(=O)CC(=N)S

Synonyms:

• 4-Morpholinepropanethioamide, Beta-Oxo-
• 3-(Morpholin-4-yl)-3-oxopropanethioamide

3-(Morpholin-4-yl)-3-oxopropanethioamide

CAS: 89984-45-2

3-(Morpholin-4-yl)-3-oxopropanethioamide

Purity: 95%

Molecular weight: 188.25g/mol

Ref: 54-OR84504

3-(Morpholin-4-yl)-3-oxopropanethioamide

CAS: 89984-45-2

Purity: 98%

Molecular weight: 188.25

Ref: 10-F651738